| ≥1 piece |
| Packaging Details: | 25kg/bag net each 17000kgs for 20FCL(without the pallet) |
|---|---|
| Delivery Detail: | 15days |
Distilled Monoglycerides(DMG)
[Molecular formula] CH200C(CH2)16CH3CHOHCH2OH
[Molecular weight] 358.87
| ITEM | GB15612-95 | Quality index of our company |
| Total Monoglyceride content | ≥90 | ≥95 |
| Acid value | ≤2.5 | ≤2.0 |
| Lodime value | ≤3.0 | ≤1.0 |
| Melting Point | ≥60 | ≥65 |
| heavyMetals | ≤0.0005 | ≤0.0005 |
| Arsenic(As) | ≤0.0001 | ≤0.0001 |
| Iron(Fe) | ≤0.0002 | ≤0.0002 |
| HLB value | 3.8 | 3.8 |
[ Packing]: 25kg/bag net each, and 17000kgs for 20FCL
Our Advantage:
1.Quality Control:before shipment, free sample for test; after shipment, keep sample for 2 years
2. Mixed container: mix different items into one container.
3. Special Packing: label and packing design
4. Prompt Shipment: within 15 days after the order confirmed.
5. Expert Service: professional documents with 10 years experience.
6. Long payment terms: 60 days; 90 days; even more